C31H32N4O4S — CID 90297623
2-[4-[[7-[4-(dimethylamino)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenoxy]acetic acid (PubChem CID 90297623) has the molecular formula C31H32N4O4S and a molecular weight of 556.69 g/mol. Its IUPAC name is 2-[4-[[7-[4-(dimethylamino)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[7-[4-(dimethylamino)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 90297623 |
| Molecular Formula | C31H32N4O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 2-[4-[[7-[4-(dimethylamino)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]phenoxy]acetic acid |
| SMILES | CN(C)c1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)Nc2ccc(OCC(=O)O)cc2)CCCC4)cc1 |
| InChI | InChI=1S/C31H32N4O4S/c1-33(2)22-13-9-20(10-14-22)29-26-7-5-17-34(26)30-25(24-6-3-4-8-27(24)40-30)18-35(29)31(38)32-21-11-15-23(16-12-21)39-19-28(36)37/h5,7,9-17,29H,3-4,6,8,18-19H2,1-2H3,(H,32,38)(H,36,37) |
| InChIKey | YHLFOGJMXNAYEF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|