C27H34N4OS — CID 92867531
(7S)-7-[4-(dimethylamino)phenyl]-N-(2-methylpropyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92867531) has the molecular formula C27H34N4OS and a molecular weight of 462.66 g/mol. Its IUPAC name is (7S)-7-[4-(dimethylamino)phenyl]-N-(2-methylpropyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-[4-(dimethylamino)phenyl]-N-(2-methylpropyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92867531 |
| Molecular Formula | C27H34N4OS |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (7S)-7-[4-(dimethylamino)phenyl]-N-(2-methylpropyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CC(C)CNC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H34N4OS/c1-18(2)16-28-27(32)31-17-22-21-8-5-6-10-24(21)33-26(22)30-15-7-9-23(30)25(31)19-11-13-20(14-12-19)29(3)4/h7,9,11-15,18,25H,5-6,8,10,16-17H2,1-4H3,(H,28,32)/t25-/m0/s1 |
| InChIKey | JZXOIPRIYJROJW-VWLOTQADSA-N |
| XLogP | 5.75 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|