C31H34N4O2S — CID 92873275
(7S)-7-[4-(dimethylamino)phenyl]-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873275) has the molecular formula C31H34N4O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is (7S)-7-[4-(dimethylamino)phenyl]-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-[4-(dimethylamino)phenyl]-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873275 |
| Molecular Formula | C31H34N4O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (7S)-7-[4-(dimethylamino)phenyl]-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1cccc(CNC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C31H34N4O2S/c1-33(2)23-15-13-22(14-16-23)29-27-11-7-17-34(27)30-26(25-10-4-5-12-28(25)38-30)20-35(29)31(36)32-19-21-8-6-9-24(18-21)37-3/h6-9,11,13-18,29H,4-5,10,12,19-20H2,1-3H3,(H,32,36)/t29-/m0/s1 |
| InChIKey | OWNCLSLGRRRCHX-LJAQVGFWSA-N |
| XLogP | 6.31 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|