C30H31N3O3S — CID 50792489
7-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 50792489) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 50792489 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 7-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)NCc2cccc(OC)c2)CCCC4)cc1 |
| InChI | InChI=1S/C30H31N3O3S/c1-35-22-14-12-21(13-15-22)28-26-10-6-16-32(26)29-25(24-9-3-4-11-27(24)37-29)19-33(28)30(34)31-18-20-7-5-8-23(17-20)36-2/h5-8,10,12-17,28H,3-4,9,11,18-19H2,1-2H3,(H,31,34) |
| InChIKey | ALLLTDBDONZBTH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |