C28H25F2N3OS2 — CID 46340330
N-(2,4-difluorophenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340330) has the molecular formula C28H25F2N3OS2 and a molecular weight of 521.66 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340330 |
| Molecular Formula | C28H25F2N3OS2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CSc1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)Nc2ccc(F)cc2F)CCCC4)cc1 |
| InChI | InChI=1S/C28H25F2N3OS2/c1-35-19-11-8-17(9-12-19)26-24-6-4-14-32(24)27-21(20-5-2-3-7-25(20)36-27)16-33(26)28(34)31-23-13-10-18(29)15-22(23)30/h4,6,8-15,26H,2-3,5,7,16H2,1H3,(H,31,34) |
| InChIKey | CPJWKAKKGLLTGR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |