C28H25F2N3O2S — CID 92724777
(7S)-7-(3,5-difluorophenyl)-N-(2-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92724777) has the molecular formula C28H25F2N3O2S and a molecular weight of 505.59 g/mol. Its IUPAC name is (7S)-7-(3,5-difluorophenyl)-N-(2-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(3,5-difluorophenyl)-N-(2-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92724777 |
| Molecular Formula | C28H25F2N3O2S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (7S)-7-(3,5-difluorophenyl)-N-(2-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C28H25F2N3O2S/c1-35-24-10-4-3-8-22(24)31-28(34)33-16-21-20-7-2-5-11-25(20)36-27(21)32-12-6-9-23(32)26(33)17-13-18(29)15-19(30)14-17/h3-4,6,8-10,12-15,26H,2,5,7,11,16H2,1H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | OFAWBKIMGILFRQ-SANMLTNESA-N |
| XLogP | 6.84 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |