C30H31N3O3S2 — CID 98220532
(7S)-N-(2,4-dimethoxyphenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 98220532) has the molecular formula C30H31N3O3S2 and a molecular weight of 545.73 g/mol. Its IUPAC name is (7S)-N-(2,4-dimethoxyphenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-N-(2,4-dimethoxyphenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 98220532 |
| Molecular Formula | C30H31N3O3S2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (7S)-N-(2,4-dimethoxyphenyl)-7-(4-methylsulfanylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1ccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2c2ccc(SC)cc2)c(OC)c1 |
| InChI | InChI=1S/C30H31N3O3S2/c1-35-20-12-15-24(26(17-20)36-2)31-30(34)33-18-23-22-7-4-5-9-27(22)38-29(23)32-16-6-8-25(32)28(33)19-10-13-21(37-3)14-11-19/h6,8,10-17,28H,4-5,7,9,18H2,1-3H3,(H,31,34)/t28-/m0/s1 |
| InChIKey | UGDCROSHJHAUBX-NDEPHWFRSA-N |
| XLogP | 7.29 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |