C26H24N2OS2 — CID 92880358
1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]-2-thiophen-2-ylethanone (PubChem CID 92880358) has the molecular formula C26H24N2OS2 and a molecular weight of 444.63 g/mol. Its IUPAC name is 1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 92880358 |
| Molecular Formula | C26H24N2OS2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H24N2OS2/c29-24(16-19-10-7-15-30-19)28-17-21-20-11-4-5-13-23(20)31-26(21)27-14-6-12-22(27)25(28)18-8-2-1-3-9-18/h1-3,6-10,12,14-15,25H,4-5,11,13,16-17H2/t25-/m1/s1 |
| InChIKey | LJCAYEGLTCDPCS-RUZDIDTESA-N |
| XLogP | 6.15 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |