C17H21N5O2S — CID 20950355
3-(6,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]propanamide (PubChem CID 20950355) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 3-(6,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]propanamide.
| Compound Name | 3-(6,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 20950355 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-(6,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-7-yl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]propanamide |
| SMILES | Cc1nn2cnnc2c(C)c1CCC(=O)NCCSCc1ccco1 |
| InChI | InChI=1S/C17H21N5O2S/c1-12-15(13(2)21-22-11-19-20-17(12)22)5-6-16(23)18-7-9-25-10-14-4-3-8-24-14/h3-4,8,11H,5-7,9-10H2,1-2H3,(H,18,23) |
| InChIKey | BCIYFNRGNCBNQZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|