C18H24FN3OS — CID 46673381
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 46673381) has the molecular formula C18H24FN3OS and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 46673381 |
| Molecular Formula | C18H24FN3OS |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C18H24FN3OS/c1-13-16(14(2)22(3)21-13)8-9-18(23)20-10-11-24-12-15-6-4-5-7-17(15)19/h4-7H,8-12H2,1-3H3,(H,20,23) |
| InChIKey | SBFACIRUFICGKK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|