C19H22FN5OS — CID 78881294
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide (PubChem CID 78881294) has the molecular formula C19H22FN5OS and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 78881294 |
| Molecular Formula | C19H22FN5OS |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C)c1-c1cc(C(=O)NCCSCc2ccccc2F)[nH]n1 |
| InChI | InChI=1S/C19H22FN5OS/c1-12-18(13(2)25(3)24-12)16-10-17(23-22-16)19(26)21-8-9-27-11-14-6-4-5-7-15(14)20/h4-7,10H,8-9,11H2,1-3H3,(H,21,26)(H,22,23) |
| InChIKey | KYRBCMKPZWYPHA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|