C26H26N4O3 — CID 20952339
N-cyclopentyl-2-[14-(4-methylphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaen-12-yl]acetamide (PubChem CID 20952339) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-cyclopentyl-2-[14-(4-methylphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaen-12-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[14-(4-methylphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaen-12-yl]acetamide |
|---|---|
| PubChem CID | 20952339 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-cyclopentyl-2-[14-(4-methylphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaen-12-yl]acetamide |
| SMILES | Cc1ccc(-c2nn(CC(=O)NC3CCCC3)c3c2cnc2cc4c(cc23)OCCO4)cc1 |
| InChI | InChI=1S/C26H26N4O3/c1-16-6-8-17(9-7-16)25-20-14-27-21-13-23-22(32-10-11-33-23)12-19(21)26(20)30(29-25)15-24(31)28-18-4-2-3-5-18/h6-9,12-14,18H,2-5,10-11,15H2,1H3,(H,28,31) |
| InChIKey | VQZGAMZWOCIUKM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |