C19H26N2O2 — CID 20954482
N-cycloheptyl-1-propanoyl-2,3-dihydroindole-2-carboxamide (PubChem CID 20954482) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-cycloheptyl-1-propanoyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | N-cycloheptyl-1-propanoyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 20954482 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-cycloheptyl-1-propanoyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCC(=O)N1c2ccccc2CC1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H26N2O2/c1-2-18(22)21-16-12-8-7-9-14(16)13-17(21)19(23)20-15-10-5-3-4-6-11-15/h7-9,12,15,17H,2-6,10-11,13H2,1H3,(H,20,23) |
| InChIKey | AYTJOHINYUFEJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |