C17H24N2O2 — CID 20954495
N-(3-methylbutyl)-1-propanoyl-2,3-dihydroindole-2-carboxamide (PubChem CID 20954495) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(3-methylbutyl)-1-propanoyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | N-(3-methylbutyl)-1-propanoyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 20954495 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(3-methylbutyl)-1-propanoyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CCC(=O)N1c2ccccc2CC1C(=O)NCCC(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-4-16(20)19-14-8-6-5-7-13(14)11-15(19)17(21)18-10-9-12(2)3/h5-8,12,15H,4,9-11H2,1-3H3,(H,18,21) |
| InChIKey | BWARLPUCKQLGQN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |