C21H28N4O3S — CID 20956811
N-(3-ethoxypropyl)-4-(3-methyl-1-phenyl-5,6-dihydropyrazolo[5,4-b][1,4]thiazin-4-yl)-4-oxobutanamide (PubChem CID 20956811) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-(3-methyl-1-phenyl-5,6-dihydropyrazolo[5,4-b][1,4]thiazin-4-yl)-4-oxobutanamide.
| Compound Name | N-(3-ethoxypropyl)-4-(3-methyl-1-phenyl-5,6-dihydropyrazolo[5,4-b][1,4]thiazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 20956811 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-(3-ethoxypropyl)-4-(3-methyl-1-phenyl-5,6-dihydropyrazolo[5,4-b][1,4]thiazin-4-yl)-4-oxobutanamide |
| SMILES | CCOCCCNC(=O)CCC(=O)N1CCSc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-3-28-14-7-12-22-18(26)10-11-19(27)24-13-15-29-21-20(24)16(2)23-25(21)17-8-5-4-6-9-17/h4-6,8-9H,3,7,10-15H2,1-2H3,(H,22,26) |
| InChIKey | OZCBFCIVBVVFPT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|