C18H28N6O2 — CID 20956883
N-(3-ethoxypropyl)-3-(6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)propanamide (PubChem CID 20956883) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-(6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)propanamide.
| Compound Name | N-(3-ethoxypropyl)-3-(6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)propanamide |
|---|---|
| PubChem CID | 20956883 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-(3-ethoxypropyl)-3-(6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)propanamide |
| SMILES | CCOCCCNC(=O)CCc1nnc2ccc(N3CCCCC3)nn12 |
| InChI | InChI=1S/C18H28N6O2/c1-2-26-14-6-11-19-18(25)10-9-16-21-20-15-7-8-17(22-24(15)16)23-12-4-3-5-13-23/h7-8H,2-6,9-14H2,1H3,(H,19,25) |
| InChIKey | WAWZTBWOWYMZMM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|