C19H17N7O3S — CID 20957454
3-[6-(1,3-benzodioxol-5-ylmethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 20957454) has the molecular formula C19H17N7O3S and a molecular weight of 423.46 g/mol. Its IUPAC name is 3-[6-(1,3-benzodioxol-5-ylmethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[6-(1,3-benzodioxol-5-ylmethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 20957454 |
| Molecular Formula | C19H17N7O3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-[6-(1,3-benzodioxol-5-ylmethylamino)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCc1nnc2ccc(NCc3ccc4c(c3)OCO4)nn12)Nc1nccs1 |
| InChI | InChI=1S/C19H17N7O3S/c27-18(22-19-20-7-8-30-19)6-5-17-24-23-16-4-3-15(25-26(16)17)21-10-12-1-2-13-14(9-12)29-11-28-13/h1-4,7-9H,5-6,10-11H2,(H,21,25)(H,20,22,27) |
| InChIKey | NAJYHWNQCONPDV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |