C24H28N2O3 — CID 20958005
4-[[2-(2-methoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid (PubChem CID 20958005) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[[2-(2-methoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(2-methoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20958005 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[[2-(2-methoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid |
| SMILES | COc1ccccc1CCNCc1c(C(=O)O)c(C)n(-c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C24H28N2O3/c1-16-9-11-20(12-10-16)26-17(2)21(23(18(26)3)24(27)28)15-25-14-13-19-7-5-6-8-22(19)29-4/h5-12,25H,13-15H2,1-4H3,(H,27,28) |
| InChIKey | GEXXVZOPSUZMKW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|