C25H30N2O4 — CID 20958024
4-[[2-(2,4-dimethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid (PubChem CID 20958024) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(2,4-dimethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20958024 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[[2-(2,4-dimethoxyphenyl)ethylamino]methyl]-2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylic acid |
| SMILES | COc1ccc(CCNCc2c(C(=O)O)c(C)n(-c3ccc(C)cc3)c2C)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-16-6-9-20(10-7-16)27-17(2)22(24(18(27)3)25(28)29)15-26-13-12-19-8-11-21(30-4)14-23(19)31-5/h6-11,14,26H,12-13,15H2,1-5H3,(H,28,29) |
| InChIKey | XTIOAAFEIDJEFZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|