C12H15N3O4S — CID 20958579
N-(3,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide (PubChem CID 20958579) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 20958579 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cn(C)cn2)cc1OC |
| InChI | InChI=1S/C12H15N3O4S/c1-15-7-12(13-8-15)20(16,17)14-9-4-5-10(18-2)11(6-9)19-3/h4-8,14H,1-3H3 |
| InChIKey | NESJHKJKKXIWDN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |