C16H21N3O2S — CID 6539216
N-(3,4-dimethoxyphenyl)-5-imidazol-1-ylpentanethioamide (PubChem CID 6539216) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-imidazol-1-ylpentanethioamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-imidazol-1-ylpentanethioamide |
|---|---|
| PubChem CID | 6539216 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-imidazol-1-ylpentanethioamide |
| SMILES | COc1ccc(NC(=S)CCCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C16H21N3O2S/c1-20-14-7-6-13(11-15(14)21-2)18-16(22)5-3-4-9-19-10-8-17-12-19/h6-8,10-12H,3-5,9H2,1-2H3,(H,18,22) |
| InChIKey | LFIQBVJUXQPZQA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|