C17H20N4O3 — CID 20959323
N-(3,5-dimethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide (PubChem CID 20959323) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 20959323 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2cnc(N3CCCC3)nc2)cc(OC)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-23-14-7-13(8-15(9-14)24-2)20-16(22)12-10-18-17(19-11-12)21-5-3-4-6-21/h7-11H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | FJGQOLQOVYWSNM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |