C23H24N4O3 — CID 53098854
N-(3,5-dimethoxyphenyl)-4-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzamide (PubChem CID 53098854) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 53098854 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-(6-pyrrolidin-1-ylpyrimidin-4-yl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(-c3cc(N4CCCC4)ncn3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-29-19-11-18(12-20(13-19)30-2)26-23(28)17-7-5-16(6-8-17)21-14-22(25-15-24-21)27-9-3-4-10-27/h5-8,11-15H,3-4,9-10H2,1-2H3,(H,26,28) |
| InChIKey | IZAFXSIGAYDGQN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |