C23H18N2O5S2 — CID 20962947
2-oxo-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)chromene-3-carboxamide (PubChem CID 20962947) has the molecular formula C23H18N2O5S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-oxo-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 20962947 |
| Molecular Formula | C23H18N2O5S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-oxo-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)N(S(=O)(=O)c1cccs1)CCC2)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H18N2O5S2/c26-22(18-13-16-5-1-2-7-20(16)30-23(18)27)24-17-10-9-15-6-3-11-25(19(15)14-17)32(28,29)21-8-4-12-31-21/h1-2,4-5,7-10,12-14H,3,6,11H2,(H,24,26) |
| InChIKey | CKYFDOVXNKBZOH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|