C25H29N3O2S2 — CID 20963479
N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide (PubChem CID 20963479) has the molecular formula C25H29N3O2S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 20963479 |
| Molecular Formula | C25H29N3O2S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-7-methyl-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide |
| SMILES | COc1ccc(N2CCN(CCNC(=O)c3cc4c(s3)-c3cc(C)sc3CC4)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O2S2/c1-17-15-21-22(31-17)8-3-18-16-23(32-24(18)21)25(29)26-9-10-27-11-13-28(14-12-27)19-4-6-20(30-2)7-5-19/h4-7,15-16H,3,8-14H2,1-2H3,(H,26,29) |
| InChIKey | NNHIEILUEJKVSM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|