C19H25N3OS2 — CID 20963426
N-[3-(4-methylpiperazin-1-yl)propyl]-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide (PubChem CID 20963426) has the molecular formula C19H25N3OS2 and a molecular weight of 375.56 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 20963426 |
| Molecular Formula | C19H25N3OS2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4,5-dihydrothieno[2,3-e][1]benzothiole-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2cc3c(s2)-c2ccsc2CC3)CC1 |
| InChI | InChI=1S/C19H25N3OS2/c1-21-8-10-22(11-9-21)7-2-6-20-19(23)17-13-14-3-4-16-15(5-12-24-16)18(14)25-17/h5,12-13H,2-4,6-11H2,1H3,(H,20,23) |
| InChIKey | DYJUHIWIDWDOLB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|