C20H18N2O5 — CID 20963655
ethyl 4-[[5-(3-methoxyphenyl)-1,3-oxazole-4-carbonyl]amino]benzoate (PubChem CID 20963655) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is ethyl 4-[[5-(3-methoxyphenyl)-1,3-oxazole-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(3-methoxyphenyl)-1,3-oxazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 20963655 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl 4-[[5-(3-methoxyphenyl)-1,3-oxazole-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ncoc2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-3-26-20(24)13-7-9-15(10-8-13)22-19(23)17-18(27-12-21-17)14-5-4-6-16(11-14)25-2/h4-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | UJRFBLIWNZTYIF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |