C24H26N4O4 — CID 126470018
N-[3-carbamoyl-4-(4-methylpiperidin-1-yl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 126470018) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[3-carbamoyl-4-(4-methylpiperidin-1-yl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-carbamoyl-4-(4-methylpiperidin-1-yl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 126470018 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[3-carbamoyl-4-(4-methylpiperidin-1-yl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc(-c2ocnc2C(=O)Nc2ccc(N3CCC(C)CC3)c(C(N)=O)c2)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-15-8-10-28(11-9-15)20-7-6-17(13-19(20)23(25)29)27-24(30)21-22(32-14-26-21)16-4-3-5-18(12-16)31-2/h3-7,12-15H,8-11H2,1-2H3,(H2,25,29)(H,27,30) |
| InChIKey | UXUJOVNUWJEQQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|