C24H26ClN3O3S — CID 20963981
1-acetyl-N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 20963981) has the molecular formula C24H26ClN3O3S and a molecular weight of 472.01 g/mol. Its IUPAC name is 1-acetyl-N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20963981 |
| Molecular Formula | C24H26ClN3O3S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-acetyl-N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)NCc3cc(C)n(-c4ccc(Cl)cc4)c3C)cc2CC1C |
| InChI | InChI=1S/C24H26ClN3O3S/c1-15-12-20(17(3)27(15)22-7-5-21(25)6-8-22)14-26-32(30,31)23-9-10-24-19(13-23)11-16(2)28(24)18(4)29/h5-10,12-13,16,26H,11,14H2,1-4H3 |
| InChIKey | RWCLDXMHHQZXOK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|