C25H29N3O4S — CID 92750568
(2R)-1-acetyl-N-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 92750568) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is (2R)-1-acetyl-N-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | (2R)-1-acetyl-N-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 92750568 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (2R)-1-acetyl-N-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | COc1ccc(-n2c(C)cc(CNS(=O)(=O)c3ccc4c(c3)C[C@@H](C)N4C(C)=O)c2C)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-16-13-21(18(3)27(16)22-6-8-23(32-5)9-7-22)15-26-33(30,31)24-10-11-25-20(14-24)12-17(2)28(25)19(4)29/h6-11,13-14,17,26H,12,15H2,1-5H3/t17-/m1/s1 |
| InChIKey | TYEBZYZZBQNJTC-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|