C26H26N4O2 — CID 20966085
4-(3-methylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]quinazoline-2-carboxamide (PubChem CID 20966085) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(3-methylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]quinazoline-2-carboxamide.
| Compound Name | 4-(3-methylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 20966085 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-(3-methylanilino)-N-[(4-propan-2-yloxyphenyl)methyl]quinazoline-2-carboxamide |
| SMILES | Cc1cccc(Nc2nc(C(=O)NCc3ccc(OC(C)C)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H26N4O2/c1-17(2)32-21-13-11-19(12-14-21)16-27-26(31)25-29-23-10-5-4-9-22(23)24(30-25)28-20-8-6-7-18(3)15-20/h4-15,17H,16H2,1-3H3,(H,27,31)(H,28,29,30) |
| InChIKey | NNNNFURYXKCXOI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |