C24H21FN4O — CID 53020396
4-(4-ethylanilino)-N-[(2-fluorophenyl)methyl]quinazoline-2-carboxamide (PubChem CID 53020396) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-(4-ethylanilino)-N-[(2-fluorophenyl)methyl]quinazoline-2-carboxamide.
| Compound Name | 4-(4-ethylanilino)-N-[(2-fluorophenyl)methyl]quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 53020396 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-(4-ethylanilino)-N-[(2-fluorophenyl)methyl]quinazoline-2-carboxamide |
| SMILES | CCc1ccc(Nc2nc(C(=O)NCc3ccccc3F)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H21FN4O/c1-2-16-11-13-18(14-12-16)27-22-19-8-4-6-10-21(19)28-23(29-22)24(30)26-15-17-7-3-5-9-20(17)25/h3-14H,2,15H2,1H3,(H,26,30)(H,27,28,29) |
| InChIKey | UBURWAOHRAYCTC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |