C19H19FN4O — CID 53020403
N-butan-2-yl-4-(4-fluoroanilino)quinazoline-2-carboxamide (PubChem CID 53020403) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is N-butan-2-yl-4-(4-fluoroanilino)quinazoline-2-carboxamide.
| Compound Name | N-butan-2-yl-4-(4-fluoroanilino)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 53020403 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-butan-2-yl-4-(4-fluoroanilino)quinazoline-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1nc(Nc2ccc(F)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C19H19FN4O/c1-3-12(2)21-19(25)18-23-16-7-5-4-6-15(16)17(24-18)22-14-10-8-13(20)9-11-14/h4-12H,3H2,1-2H3,(H,21,25)(H,22,23,24) |
| InChIKey | GDOBORXAUXUZSF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |