C16H22N2O3S — CID 20967438
2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 20967438) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 20967438 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(2,2-dimethyl-4-oxo-3H-1,5-benzothiazepin-5-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)CC(C)(C)Sc2ccccc21 |
| InChI | InChI=1S/C16H22N2O3S/c1-16(2)10-15(20)18(11-14(19)17-8-9-21-3)12-6-4-5-7-13(12)22-16/h4-7H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | ULJYUNZQEZDLLT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|