C28H36N4O3S2 — CID 20968660
N-(3-butylsulfanylpropyl)-6-(4-methylpiperidin-1-yl)sulfonyl-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 20968660) has the molecular formula C28H36N4O3S2 and a molecular weight of 540.76 g/mol. Its IUPAC name is N-(3-butylsulfanylpropyl)-6-(4-methylpiperidin-1-yl)sulfonyl-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-(3-butylsulfanylpropyl)-6-(4-methylpiperidin-1-yl)sulfonyl-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 20968660 |
| Molecular Formula | C28H36N4O3S2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | N-(3-butylsulfanylpropyl)-6-(4-methylpiperidin-1-yl)sulfonyl-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CCCCSCCCNC(=O)c1cc(-c2ccncc2)nc2ccc(S(=O)(=O)N3CCC(C)CC3)cc12 |
| InChI | InChI=1S/C28H36N4O3S2/c1-3-4-17-36-18-5-12-30-28(33)25-20-27(22-8-13-29-14-9-22)31-26-7-6-23(19-24(25)26)37(34,35)32-15-10-21(2)11-16-32/h6-9,13-14,19-21H,3-5,10-12,15-18H2,1-2H3,(H,30,33) |
| InChIKey | AMBYQTRHYJRELO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|