C23H28N4O4S — CID 4642300
6-(butylsulfamoyl)-N-(3-methoxypropyl)-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 4642300) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 6-(butylsulfamoyl)-N-(3-methoxypropyl)-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 6-(butylsulfamoyl)-N-(3-methoxypropyl)-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4642300 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 6-(butylsulfamoyl)-N-(3-methoxypropyl)-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(-c3cccnc3)cc(C(=O)NCCCOC)c2c1 |
| InChI | InChI=1S/C23H28N4O4S/c1-3-4-12-26-32(29,30)18-8-9-21-19(14-18)20(23(28)25-11-6-13-31-2)15-22(27-21)17-7-5-10-24-16-17/h5,7-10,14-16,26H,3-4,6,11-13H2,1-2H3,(H,25,28) |
| InChIKey | KVDVVSHPSVPFFU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|