C28H38N4O3S2 — CID 98366221
6-(butylsulfamoyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 98366221) has the molecular formula C28H38N4O3S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is 6-(butylsulfamoyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | 6-(butylsulfamoyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 98366221 |
| Molecular Formula | C28H38N4O3S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 6-(butylsulfamoyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2nc(-c3cccs3)cc(C(=O)NCCCN3C[C@H](C)C[C@@H](C)C3)c2c1 |
| InChI | InChI=1S/C28H38N4O3S2/c1-4-5-12-30-37(34,35)22-9-10-25-23(16-22)24(17-26(31-25)27-8-6-14-36-27)28(33)29-11-7-13-32-18-20(2)15-21(3)19-32/h6,8-10,14,16-17,20-21,30H,4-5,7,11-13,15,18-19H2,1-3H3,(H,29,33)/t20-,21-/m1/s1 |
| InChIKey | DLEFYVSGRCYCHD-NHCUHLMSSA-N |
| XLogP | 5.14 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|