C22H25N3OS — CID 42659166
6-methyl-N-(2-piperidin-1-ylethyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 42659166) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 6-methyl-N-(2-piperidin-1-ylethyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | 6-methyl-N-(2-piperidin-1-ylethyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42659166 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 6-methyl-N-(2-piperidin-1-ylethyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3cccs3)cc(C(=O)NCCN3CCCCC3)c2c1 |
| InChI | InChI=1S/C22H25N3OS/c1-16-7-8-19-17(14-16)18(15-20(24-19)21-6-5-13-27-21)22(26)23-9-12-25-10-3-2-4-11-25/h5-8,13-15H,2-4,9-12H2,1H3,(H,23,26) |
| InChIKey | KFTKRMZPNDUXLC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |