C31H41N3O3 — CID 20968872
N-[1-(4-butoxyphenyl)ethyl]-1-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 20968872) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)ethyl]-1-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[1-(4-butoxyphenyl)ethyl]-1-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20968872 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | N-[1-(4-butoxyphenyl)ethyl]-1-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(C(C)NC(=O)C2CCN(Cc3nc(-c4ccc(CC)cc4)oc3C)CC2)cc1 |
| InChI | InChI=1S/C31H41N3O3/c1-5-7-20-36-28-14-12-25(13-15-28)22(3)32-30(35)26-16-18-34(19-17-26)21-29-23(4)37-31(33-29)27-10-8-24(6-2)9-11-27/h8-15,22,26H,5-7,16-21H2,1-4H3,(H,32,35) |
| InChIKey | LCNHHHNXAPAVOP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|