C21H28ClN3O2 — CID 20859816
N-butyl-1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 20859816) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-butyl-1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20859816 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-butyl-1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(Cc2nc(-c3ccc(Cl)cc3)oc2C)CC1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-3-4-11-23-20(26)16-9-12-25(13-10-16)14-19-15(2)27-21(24-19)17-5-7-18(22)8-6-17/h5-8,16H,3-4,9-14H2,1-2H3,(H,23,26) |
| InChIKey | MDAMIDFBCQDISQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|