C25H37N5O2 — CID 45280479
N-[3-(azepan-1-yl)propyl]-1-[(5-methyl-2-pyridin-4-yl-1,3-oxazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 45280479) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[(5-methyl-2-pyridin-4-yl-1,3-oxazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[(5-methyl-2-pyridin-4-yl-1,3-oxazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45280479 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[(5-methyl-2-pyridin-4-yl-1,3-oxazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1oc(-c2ccncc2)nc1CN1CCC(C(=O)NCCCN2CCCCCC2)CC1 |
| InChI | InChI=1S/C25H37N5O2/c1-20-23(28-25(32-20)22-7-12-26-13-8-22)19-30-17-9-21(10-18-30)24(31)27-11-6-16-29-14-4-2-3-5-15-29/h7-8,12-13,21H,2-6,9-11,14-19H2,1H3,(H,27,31) |
| InChIKey | RRJRIIDSTPKFLO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|