C28H42N4O4 — CID 45280539
N-[3-(azepan-1-yl)propyl]-1-[[2-(2,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 45280539) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[[2-(2,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[[2-(2,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45280539 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[[2-(2,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2nc(CN3CCC(C(=O)NCCCN4CCCCCC4)CC3)c(C)o2)c(OC)c1 |
| InChI | InChI=1S/C28H42N4O4/c1-21-25(30-28(36-21)24-10-9-23(34-2)19-26(24)35-3)20-32-17-11-22(12-18-32)27(33)29-13-8-16-31-14-6-4-5-7-15-31/h9-10,19,22H,4-8,11-18,20H2,1-3H3,(H,29,33) |
| InChIKey | KREKQYLXHKJCQL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|