C21H30N2O5 — CID 45228007
2-(2,4-dimethoxyphenyl)-4-[[4-(2-methoxyethoxy)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole (PubChem CID 45228007) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4-[[4-(2-methoxyethoxy)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-(2,4-dimethoxyphenyl)-4-[[4-(2-methoxyethoxy)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 45228007 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4-[[4-(2-methoxyethoxy)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole |
| SMILES | COCCOC1CCN(Cc2nc(-c3ccc(OC)cc3OC)oc2C)CC1 |
| InChI | InChI=1S/C21H30N2O5/c1-15-19(14-23-9-7-16(8-10-23)27-12-11-24-2)22-21(28-15)18-6-5-17(25-3)13-20(18)26-4/h5-6,13,16H,7-12,14H2,1-4H3 |
| InChIKey | GOIRTZWZCLTNPQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|