C22H32N2O4 — CID 42304580
2-(2,5-dimethoxyphenyl)-4-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole (PubChem CID 42304580) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-4-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-(2,5-dimethoxyphenyl)-4-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 42304580 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-4-[[4-(3-methoxypropyl)piperidin-1-yl]methyl]-5-methyl-1,3-oxazole |
| SMILES | COCCCC1CCN(Cc2nc(-c3cc(OC)ccc3OC)oc2C)CC1 |
| InChI | InChI=1S/C22H32N2O4/c1-16-20(15-24-11-9-17(10-12-24)6-5-13-25-2)23-22(28-16)19-14-18(26-3)7-8-21(19)27-4/h7-8,14,17H,5-6,9-13,15H2,1-4H3 |
| InChIKey | BQIGOKVDRLFHOT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|