C27H33ClN4O2 — CID 20859831
1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide (PubChem CID 20859831) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20859831 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)nc1CN1CCC(C(=O)NCCCN(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H33ClN4O2/c1-20-25(30-27(34-20)22-9-11-23(28)12-10-22)19-32-17-13-21(14-18-32)26(33)29-15-6-16-31(2)24-7-4-3-5-8-24/h3-5,7-12,21H,6,13-19H2,1-2H3,(H,29,33) |
| InChIKey | FHQCVGGSZYDSPB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|