C28H36N4O2 — CID 20859850
N-[3-(N-methylanilino)propyl]-1-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 20859850) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-1-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-1-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20859850 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-1-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccccc1-c1nc(CN2CCC(C(=O)NCCCN(C)c3ccccc3)CC2)c(C)o1 |
| InChI | InChI=1S/C28H36N4O2/c1-21-10-7-8-13-25(21)28-30-26(22(2)34-28)20-32-18-14-23(15-19-32)27(33)29-16-9-17-31(3)24-11-5-4-6-12-24/h4-8,10-13,23H,9,14-20H2,1-3H3,(H,29,33) |
| InChIKey | KEOHFYHNLAGPLV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|