C26H37N3O3 — CID 129060912
4-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide (PubChem CID 129060912) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 129060912 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 4-[[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl]-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccccc1-c1nc(CC2CCC(C(=O)NCCCN3CCOCC3)CC2)c(C)o1 |
| InChI | InChI=1S/C26H37N3O3/c1-19-6-3-4-7-23(19)26-28-24(20(2)32-26)18-21-8-10-22(11-9-21)25(30)27-12-5-13-29-14-16-31-17-15-29/h3-4,6-7,21-22H,5,8-18H2,1-2H3,(H,27,30) |
| InChIKey | MLMVIQZBIPTDRE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|