C21H33N3O4S — CID 20968626
4-(benzenesulfonamidomethyl)-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide (PubChem CID 20968626) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 4-(benzenesulfonamidomethyl)-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(benzenesulfonamidomethyl)-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20968626 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-(benzenesulfonamidomethyl)-N-(3-morpholin-4-ylpropyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)C1CCC(CNS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O4S/c25-21(22-11-4-12-24-13-15-28-16-14-24)19-9-7-18(8-10-19)17-23-29(26,27)20-5-2-1-3-6-20/h1-3,5-6,18-19,23H,4,7-17H2,(H,22,25) |
| InChIKey | DKGRRPDFRULLRM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|