C24H20ClF3N2O2 — CID 20970395
4-chloro-2-[4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 20970395) has the molecular formula C24H20ClF3N2O2 and a molecular weight of 460.88 g/mol. Its IUPAC name is 4-chloro-2-[4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-chloro-2-[4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 20970395 |
| Molecular Formula | C24H20ClF3N2O2 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-chloro-2-[4-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1ccc(C2=NC(c3ccc(C(F)(F)F)cc3)NC(c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C24H20ClF3N2O2/c1-32-18-9-4-14(5-10-18)20-13-21(19-12-17(25)8-11-22(19)31)30-23(29-20)15-2-6-16(7-3-15)24(26,27)28/h2-12,21,23,30-31H,13H2,1H3 |
| InChIKey | VRVGODHJPYIHDN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|