C23H20Cl2N2O2 — CID 92697920
4-chloro-2-[(2R,6R)-2-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 92697920) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-chloro-2-[(2R,6R)-2-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-chloro-2-[(2R,6R)-2-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 92697920 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-chloro-2-[(2R,6R)-2-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1ccc(C2=N[C@H](c3ccccc3Cl)N[C@@H](c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-29-16-9-6-14(7-10-16)20-13-21(18-12-15(24)8-11-22(18)28)27-23(26-20)17-4-2-3-5-19(17)25/h2-12,21,23,27-28H,13H2,1H3/t21-,23+/m1/s1 |
| InChIKey | HUTPKVVZGOFERR-GGAORHGYSA-N |
| XLogP | 5.93 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|